CAS 1082041-92-6
:6-Nitro-1H-indazol-4-amine
Description:
6-Nitro-1H-indazol-4-amine is a chemical compound characterized by its indazole core, which is a five-membered heterocyclic structure containing two nitrogen atoms. The presence of a nitro group at the 6-position and an amino group at the 4-position contributes to its reactivity and potential applications in medicinal chemistry. This compound is typically a solid at room temperature and may exhibit moderate solubility in polar solvents due to the presence of the amino group. Its molecular structure suggests potential for hydrogen bonding, which can influence its interactions with biological targets. 6-Nitro-1H-indazol-4-amine may be of interest in research related to pharmaceuticals, particularly in the development of compounds with anti-cancer or anti-inflammatory properties. As with many nitro-substituted compounds, it is essential to handle it with care due to potential toxicity and environmental concerns. Proper safety protocols should be followed when working with this substance in a laboratory setting.
Formula:C7H6N4O2
InChI:InChI=1S/C7H6N4O2/c8-6-1-4(11(12)13)2-7-5(6)3-9-10-7/h1-3H,8H2,(H,9,10)
InChI key:InChIKey=PXAQCICIBJWARO-UHFFFAOYSA-N
SMILES:NC1=C2C(=CC(N(=O)=O)=C1)NN=C2
Synonyms:- 6-Nitro-1H-indazol-4-amine
- 1H-Indazol-4-amine, 6-nitro-
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.