CAS 1082041-93-7

3,4-Dibromo-1H-indazole-6-carbonitrile

Description:

3,4-Dibromo-1H-indazole-6-carbonitrile is a chemical compound characterized by its indazole core, which is a five-membered aromatic ring containing two nitrogen atoms. The presence of bromine substituents at the 3 and 4 positions enhances its reactivity and potential applications in various chemical reactions, particularly in the synthesis of pharmaceuticals and agrochemicals. The carbonitrile functional group at the 6 position contributes to its polarity and can participate in nucleophilic reactions. This compound is typically solid at room temperature and may exhibit moderate solubility in organic solvents. Its molecular structure suggests potential biological activity, making it of interest in medicinal chemistry. Additionally, the presence of halogens like bromine can influence the compound's electronic properties, potentially affecting its interaction with biological targets. Safety data should be consulted for handling, as halogenated compounds can pose health risks. Overall, 3,4-Dibromo-1H-indazole-6-carbonitrile is a versatile compound with significant implications in synthetic organic chemistry and drug development.

Formula: C₈H₃Br₂N₃

InChI: InChI=1S/C8H3Br2N3/c9-5-1-4(3-11)2-6-7(5)8(10)13-12-6/h1-2H,(H,12,13)

InChI key: InChIKey=SFMYVEOMIDWQOR-UHFFFAOYSA-N

SMILES: BrC1=C2C(=CC(C#N)=C1)NN=C2Br

Synonyms:

• 3,4-Dibromo-1H-indazole-6-carbonitrile
• 1H-Indazole-6-carbonitrile, 3,4-dibromo-