CAS 1082041-94-8

3-Fluoro-2-methyl-4,5-dinitrobenzenamine

Description:

3-Fluoro-2-methyl-4,5-dinitrobenzenamine is an organic compound characterized by the presence of a fluorine atom, a methyl group, and two nitro groups attached to a benzene ring, along with an amine functional group. This compound belongs to the class of substituted anilines, which are known for their diverse applications in pharmaceuticals, dyes, and agrochemicals. The presence of the nitro groups typically imparts significant electron-withdrawing properties, influencing the compound's reactivity and stability. The fluorine atom can enhance lipophilicity and may affect the compound's biological activity. The molecular structure suggests potential for hydrogen bonding due to the amine group, which can influence solubility and interaction with biological targets. Additionally, the compound may exhibit various physical properties such as melting point, boiling point, and solubility, which are essential for its practical applications. Safety and handling considerations are crucial, as nitro compounds can be sensitive and potentially hazardous. Overall, 3-Fluoro-2-methyl-4,5-dinitrobenzenamine is a complex molecule with unique characteristics that warrant further investigation for its potential uses.

Formula: C₇H₆FN₃O₄

InChI: InChI=1S/C7H6FN3O4/c1-3-4(9)2-5(10(12)13)7(6(3)8)11(14)15/h2H,9H2,1H3

InChI key: InChIKey=QCKLCHIWKANNFT-UHFFFAOYSA-N

SMILES: N(=O)(=O)C1=C(N(=O)=O)C=C(N)C(C)=C1F

Synonyms:

• Benzenamine, 3-fluoro-2-methyl-4,5-dinitro-
• 3-Fluoro-2-methyl-4,5-dinitrobenzenamine