CAS 1082041-97-1

6-Methyl-3-nitro-1H-indazole

Description:

6-Methyl-3-nitro-1H-indazole is a chemical compound characterized by its indazole core, which is a bicyclic structure containing a five-membered ring fused to a six-membered ring. The presence of a methyl group at the 6-position and a nitro group at the 3-position contributes to its unique chemical properties. This compound is typically a solid at room temperature and may exhibit moderate solubility in organic solvents. Its nitro group can participate in various chemical reactions, making it a potential candidate for further functionalization. The compound may also display biological activity, which is of interest in medicinal chemistry and drug development. As with many nitro-containing compounds, it may be subject to specific safety and handling considerations due to potential toxicity. Overall, 6-Methyl-3-nitro-1H-indazole is a versatile compound with applications in research and industry, particularly in the fields of pharmaceuticals and organic synthesis.

Formula: C₈H₇N₃O₂

InChI: InChI=1S/C8H7N3O2/c1-5-2-3-6-7(4-5)9-10-8(6)11(12)13/h2-4H,1H3,(H,9,10)

InChI key: InChIKey=PZJYLFMRVWUELH-UHFFFAOYSA-N

SMILES: N(=O)(=O)C=1C=2C(NN1)=CC(C)=CC2

Synonyms:

• 1H-Indazole, 6-methyl-3-nitro-
• 6-Methyl-3-nitro-1H-indazole