CymitQuimica logo

CAS 1082042-05-4

:

3-Chloro-4,6-diiodo-1H-indazole

Description:
3-Chloro-4,6-diiodo-1H-indazole is a chemical compound characterized by its indazole core, which is a bicyclic structure containing a five-membered ring fused to a six-membered ring. The presence of chlorine and iodine substituents at specific positions (3-chloro and 4,6-diiodo) significantly influences its chemical properties and reactivity. This compound is typically a solid at room temperature and may exhibit a range of colors depending on its purity and crystalline form. It is likely to be insoluble or poorly soluble in water but may dissolve in organic solvents. The halogen substituents can impart unique electronic properties, making it of interest in various fields, including medicinal chemistry and materials science. Additionally, the compound may exhibit biological activity, which could be explored for potential applications in pharmaceuticals. As with many halogenated compounds, it is essential to handle it with care due to potential toxicity and environmental concerns. Always refer to safety data sheets and conduct proper risk assessments when working with such substances.
Formula:C7H3ClI2N2
InChI:InChI=1S/C7H3ClI2N2/c8-7-6-4(10)1-3(9)2-5(6)11-12-7/h1-2H,(H,11,12)
InChI key:InChIKey=ORMKPHDGOVPLMA-UHFFFAOYSA-N
SMILES:IC1=C2C(=CC(I)=C1)NN=C2Cl
Synonyms:
  • 1H-Indazole, 3-chloro-4,6-diiodo-
  • 3-Chloro-4,6-diiodo-1H-indazole
Sort by

The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.