CAS 1082042-06-5
:4,7-Difluoro-1H-indazole-3-carboxaldehyde
Description:
4,7-Difluoro-1H-indazole-3-carboxaldehyde is a chemical compound characterized by its indazole core, which is a five-membered heterocyclic structure containing two nitrogen atoms. The presence of two fluorine atoms at the 4 and 7 positions contributes to its unique reactivity and potential applications in medicinal chemistry. The carboxaldehyde functional group at the 3-position enhances its reactivity, making it a valuable intermediate in organic synthesis. This compound is typically a solid at room temperature and may exhibit moderate solubility in polar organic solvents. Its fluorinated nature may impart distinct electronic properties, influencing its interactions with biological targets. Additionally, the compound's structure suggests potential applications in the development of pharmaceuticals, agrochemicals, or as a building block in the synthesis of more complex molecules. Safety data should be consulted for handling, as fluorinated compounds can exhibit specific hazards. Overall, 4,7-Difluoro-1H-indazole-3-carboxaldehyde is of interest in various fields, particularly in drug discovery and materials science.
Formula:C8H4F2N2O
InChI:InChI=1S/C8H4F2N2O/c9-4-1-2-5(10)8-7(4)6(3-13)11-12-8/h1-3H,(H,11,12)
InChI key:InChIKey=BXSKOVYJIAWQAJ-UHFFFAOYSA-N
SMILES:C(=O)C=1C=2C(=C(F)C=CC2F)NN1
Synonyms:- 1H-Indazole-3-carboxaldehyde, 4,7-difluoro-
- 4,7-Difluoro-1H-indazole-3-carboxaldehyde
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.