CAS 1082042-10-1

5,7-Dibromo-3,4-dihydro-1(2H)-isoquinolinone

Description:

5,7-Dibromo-3,4-dihydro-1(2H)-isoquinolinone is a chemical compound characterized by its isoquinolinone structure, which features a bicyclic system comprising a benzene ring fused to a pyrrolidine-like ring. The presence of two bromine atoms at the 5 and 7 positions contributes to its reactivity and potential applications in various chemical reactions, including electrophilic substitutions. This compound is typically a solid at room temperature and may exhibit moderate solubility in organic solvents, depending on the specific solvent properties. Its molecular structure suggests potential biological activity, making it of interest in medicinal chemistry for the development of pharmaceuticals. The compound's CAS number, 1082042-10-1, allows for precise identification and retrieval of information in chemical databases. Safety data should be consulted to understand its handling, storage, and potential hazards, as halogenated compounds can exhibit toxicity and environmental persistence. Overall, 5,7-Dibromo-3,4-dihydro-1(2H)-isoquinolinone represents a valuable compound for research and development in organic synthesis and drug discovery.

Formula: C₉H₇Br₂NO

InChI: InChI=1S/C9H7Br2NO/c10-5-3-7-6(8(11)4-5)1-2-12-9(7)13/h3-4H,1-2H2,(H,12,13)

InChI key: InChIKey=CGFMMAVRQJITIF-UHFFFAOYSA-N

SMILES: BrC1=C2C(=CC(Br)=C1)C(=O)NCC2

Synonyms:

• 1(2H)-Isoquinolinone, 5,7-dibromo-3,4-dihydro-
• 5,7-Dibromo-3,4-dihydro-1(2H)-isoquinolinone