CymitQuimica logo

CAS 1082042-21-4

:

5-Methoxy-7-methyl-1H-pyrrolo[2,3-c]pyridine

Description:
5-Methoxy-7-methyl-1H-pyrrolo[2,3-c]pyridine is a heterocyclic organic compound characterized by its fused pyrrole and pyridine rings. This compound features a methoxy group (-OCH3) and a methyl group (-CH3) at specific positions on the pyrrolo structure, which can influence its chemical reactivity and biological activity. The presence of these substituents can enhance lipophilicity and potentially affect the compound's pharmacokinetic properties. Typically, such compounds may exhibit interesting biological activities, including potential neuroprotective or anti-inflammatory effects, making them of interest in medicinal chemistry. The molecular structure contributes to its unique properties, including solubility and stability, which are crucial for its application in research and development. Additionally, the compound's CAS number, 1082042-21-4, serves as a unique identifier for regulatory and safety information. Overall, 5-Methoxy-7-methyl-1H-pyrrolo[2,3-c]pyridine represents a class of compounds that may have significant implications in drug discovery and development.
Formula:C9H10N2O
InChI:InChI=1S/C9H10N2O/c1-6-9-7(3-4-10-9)5-8(11-6)12-2/h3-5,10H,1-2H3
InChI key:InChIKey=APWUSAPINPAZML-UHFFFAOYSA-N
SMILES:CC1=C2C(=CC(OC)=N1)C=CN2
Synonyms:
  • 1H-Pyrrolo[2,3-c]pyridine, 5-methoxy-7-methyl-
  • 5-Methoxy-7-methyl-1H-pyrrolo[2,3-c]pyridine
Sort by

The purity filter is not visible because current products do not have associated purity data for filtering.
Found 1 products.