CAS 108206-24-2

1-(2-Furanylcarbonyl)-4-piperidinone

Description:

1-(2-Furanylcarbonyl)-4-piperidinone, with the CAS number 108206-24-2, is a chemical compound characterized by its unique structure that includes a piperidinone ring and a furanylcarbonyl group. This compound typically exhibits properties associated with both heterocyclic and carbonyl functionalities, which can influence its reactivity and interactions in various chemical environments. The presence of the furan ring contributes to its aromatic characteristics, potentially enhancing its stability and solubility in organic solvents. Additionally, the piperidinone moiety may impart basic properties, allowing it to participate in various chemical reactions, such as nucleophilic substitutions or cyclization processes. This compound may also exhibit biological activity, making it of interest in medicinal chemistry and drug development. Its specific applications and behavior in reactions can vary based on the conditions and the presence of other reagents. Overall, 1-(2-Furanylcarbonyl)-4-piperidinone is a versatile compound with potential implications in both synthetic and pharmaceutical chemistry.

Formula: C₁₀H₁₁NO₃

InChI: InChI=1S/C10H11NO3/c12-8-3-5-11(6-4-8)10(13)9-2-1-7-14-9/h1-2,7H,3-6H2

InChI key: InChIKey=OOHYAFZVSIYUTB-UHFFFAOYSA-N

SMILES: C(=O)(N1CCC(=O)CC1)C2=CC=CO2

Synonyms:

• 1-[(Furan-2-yl)carbonyl]piperidin-4-one
• 4-Piperidinone, 1-(2-furanylcarbonyl)-
• 1-(Furan-2-carbonyl)piperidin-4-one
• 1-(2-Furoyl)-4-piperidone
• 1-(2-Furanylcarbonyl)-4-piperidinone

1-(Furan-2-carbonyl)piperidin-4-one

Controlled Product

CAS: 108206-24-2

Versatile small molecule scaffold

Formula: C₁₀H₁₁NO₃

Purity: Min. 95%

Molecular weight: 193.2 g/mol

Ref: 3D-IEA20624