CAS 1082065-80-2

1,5-Dimethyl-3-(trifluoromethyl)-1H-pyrazole-4-carboxaldehyde

Description:

1,5-Dimethyl-3-(trifluoromethyl)-1H-pyrazole-4-carboxaldehyde is a chemical compound characterized by its pyrazole ring structure, which is a five-membered heterocyclic compound containing two nitrogen atoms. The presence of two methyl groups at the 1 and 5 positions contributes to its hydrophobic characteristics, while the trifluoromethyl group at the 3 position enhances its electron-withdrawing properties, making it a potentially reactive compound in various chemical reactions. The aldehyde functional group at the 4 position introduces reactivity typical of aldehydes, such as nucleophilic addition reactions. This compound may exhibit interesting biological activities and could be of interest in medicinal chemistry or agrochemical applications. Its unique combination of functional groups suggests potential for diverse applications, including as a building block in organic synthesis or as a precursor for more complex molecules. Safety and handling precautions should be observed due to the presence of fluorinated groups, which can impart toxicity and environmental persistence.

Formula: C₇H₇F₃N₂O

InChI: InChI=1S/C7H7F3N2O/c1-4-5(3-13)6(7(8,9)10)11-12(4)2/h3H,1-2H3

InChI key: InChIKey=DMGKXNTYDCQTHN-UHFFFAOYSA-N

SMILES: C(F)(F)(F)C=1C(C=O)=C(C)N(C)N1

Synonyms:

• 1,5-Dimethyl-3-(trifluoromethyl)pyrazole-4-carbaldehyde
• 1,5-Dimethyl-3-(trifluoromethyl)-1H-pyrazole-4-carboxaldehyde
• 1H-Pyrazole-4-carboxaldehyde, 1,5-dimethyl-3-(trifluoromethyl)-