CAS 1082065-99-3
:1-(Cyclopropylmethyl)-1H-pyrazole-4-carboxaldehyde
Description:
1-(Cyclopropylmethyl)-1H-pyrazole-4-carboxaldehyde is a chemical compound characterized by its unique structure, which includes a pyrazole ring and a cyclopropylmethyl group. This compound features a carboxaldehyde functional group, which is indicative of its reactivity and potential applications in organic synthesis. The presence of the cyclopropyl group contributes to its steric properties, potentially influencing its interactions with biological targets or other chemical species. The pyrazole moiety is known for its diverse biological activities, making this compound of interest in medicinal chemistry. Its molecular structure allows for various functionalization possibilities, which can be explored for the development of new pharmaceuticals or agrochemicals. Additionally, the compound's solubility and stability in different solvents can vary, affecting its practical applications in laboratory settings. Overall, 1-(Cyclopropylmethyl)-1H-pyrazole-4-carboxaldehyde represents a versatile building block in synthetic chemistry, with potential implications in drug discovery and development.
Formula:C8H10N2O
InChI:InChI=1S/C8H10N2O/c11-6-8-3-9-10(5-8)4-7-1-2-7/h3,5-7H,1-2,4H2
InChI key:InChIKey=BUTTVUBNXIIXRH-UHFFFAOYSA-N
SMILES:C(N1C=C(C=O)C=N1)C2CC2
Synonyms:- 1-(Cyclopropylmethyl)-1H-pyrazole-4-carboxaldehyde
- 1H-Pyrazole-4-carboxaldehyde, 1-(cyclopropylmethyl)-
- 1-(Cyclopropylmethyl)-1H-pyrazole-4-carbaldehyde
- 1-Cyclopropylmethyl-1H-pyrazole-4-carbaldehyde
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.