CymitQuimica logo

CAS 108223-79-6

:

1-[2-(2-Chloroethoxy)ethyl]-1H-1,2,4-triazole

Description:
1-[2-(2-Chloroethoxy)ethyl]-1H-1,2,4-triazole is a chemical compound characterized by its triazole ring, which is a five-membered heterocyclic structure containing three nitrogen atoms. This compound features a chloroethoxy group, contributing to its potential as a bioactive molecule. It is typically a colorless to pale yellow liquid or solid, depending on its form and purity. The presence of the chloroethoxy moiety suggests that it may exhibit properties such as solubility in organic solvents and potential reactivity with nucleophiles. The triazole ring is known for its role in various biological activities, including antifungal and herbicidal properties. Additionally, compounds like this one may interact with biological systems, making them of interest in pharmaceutical and agricultural applications. Safety data sheets should be consulted for handling and toxicity information, as halogenated compounds can pose environmental and health risks. Overall, this compound exemplifies the diverse chemistry associated with triazoles and their derivatives.
Formula:C6H10ClN3O
InChI:InChI=1S/C6H10ClN3O/c7-1-3-11-4-2-10-6-8-5-9-10/h5-6H,1-4H2
InChI key:InChIKey=FBCUVDLEVSDCIY-UHFFFAOYSA-N
SMILES:C(COCCCl)N1C=NC=N1
Synonyms:
  • 1-[2-(2-Chloroethoxy)ethyl]-1H-1,2,4-triazole
  • 1H-1,2,4-Triazole, 1-[2-(2-chloroethoxy)ethyl]-
Sort by

The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.