CymitQuimica logo

CAS 1082262-38-1

:

N-Cyclohexyl-4-hydroxybenzenesulfonamide

Description:
N-Cyclohexyl-4-hydroxybenzenesulfonamide is a chemical compound characterized by its sulfonamide functional group, which is known for its antibacterial properties. This compound features a cyclohexyl group attached to the nitrogen atom of the sulfonamide, contributing to its hydrophobic characteristics. The presence of a hydroxy group on the benzene ring enhances its solubility in polar solvents and may influence its biological activity. The sulfonamide moiety is typically associated with various pharmacological effects, including potential anti-inflammatory and analgesic properties. The compound's structure suggests it may interact with biological targets, making it of interest in medicinal chemistry. Additionally, its stability and reactivity can be influenced by the substituents on the aromatic ring and the cyclohexyl group. Overall, N-Cyclohexyl-4-hydroxybenzenesulfonamide represents a class of compounds that may have applications in pharmaceuticals, particularly in the development of new therapeutic agents.
Formula:C12H17NO3S
InChI:InChI=1S/C12H17NO3S/c14-11-6-8-12(9-7-11)17(15,16)13-10-4-2-1-3-5-10/h6-10,13-14H,1-5H2
InChI key:InChIKey=RIJRDUJYTCDLJV-UHFFFAOYSA-N
SMILES:S(NC1CCCCC1)(=O)(=O)C2=CC=C(O)C=C2
Synonyms:
  • N-Cyclohexyl-4-hydroxybenzenesulfonamide
  • Benzenesulfonamide, N-cyclohexyl-4-hydroxy-
Sort by

The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.