CymitQuimica logo

CAS 1082366-76-4

:

1-(2,3-Dihydro-1,4-benzodioxin-6-yl)-1,5-dihydro-4H-pyrazolo[3,4-d]pyrimidin-4-one

Description:
1-(2,3-Dihydro-1,4-benzodioxin-6-yl)-1,5-dihydro-4H-pyrazolo[3,4-d]pyrimidin-4-one is a chemical compound characterized by its complex structure, which includes a benzodioxin moiety and a pyrazolopyrimidinone framework. This compound typically exhibits properties such as moderate solubility in organic solvents and potential bioactivity, making it of interest in medicinal chemistry. The presence of the benzodioxin group may contribute to its pharmacological properties, possibly influencing interactions with biological targets. The pyrazolopyrimidinone core is often associated with various biological activities, including anti-inflammatory and anticancer effects. As with many heterocyclic compounds, its reactivity can be influenced by the functional groups present, allowing for potential modifications to enhance efficacy or selectivity in therapeutic applications. Safety and handling considerations are essential, as with any chemical substance, and further studies are often required to fully elucidate its biological mechanisms and potential applications in drug development.
Formula:C13H10N4O3
InChI:InChI=1S/C13H10N4O3/c18-13-9-6-16-17(12(9)14-7-15-13)8-1-2-10-11(5-8)20-4-3-19-10/h1-2,5-7H,3-4H2,(H,14,15,18)
InChI key:InChIKey=VBLGKIURBJUQTK-UHFFFAOYSA-N
SMILES:O=C1C2=C(N(N=C2)C=3C=C4C(=CC3)OCCO4)NC=N1
Synonyms:
  • 4H-Pyrazolo[3,4-d]pyrimidin-4-one, 1-(2,3-dihydro-1,4-benzodioxin-6-yl)-1,5-dihydro-
  • 1-(2,3-Dihydro-1,4-benzodioxin-6-yl)-1,5-dihydro-4H-pyrazolo[3,4-d]pyrimidin-4-one
  • 1-(2,3-Dihydro-benzo[1,4]dioxin-6-yl)-1,5-dihydro-pyrazolo[3,4-d]pyrimidin-4-one
  • 1-(2,3-Dihydro-1,4-benzodioxin-6-yl)-1H,4H,5H-pyrazolo[3,4-d]pyrimidin-4-one
Sort by

The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.