
CAS 1082373-83-8
:Spiro[4.5]decane-8-methanol
Description:
Spiro[4.5]decane-8-methanol is a bicyclic organic compound characterized by its unique spiro structure, which consists of two fused rings sharing a single carbon atom. This compound features a hydroxymethyl group (-CH2OH) at the 8-position of the spiro framework, contributing to its reactivity and potential applications in organic synthesis. The presence of the hydroxymethyl group enhances its solubility in polar solvents and may influence its interaction with biological systems. Spiro[4.5]decane-8-methanol is typically colorless to pale yellow and may exhibit a distinctive odor. Its molecular structure allows for various stereochemical configurations, which can affect its physical and chemical properties. The compound may be of interest in the fields of medicinal chemistry and materials science due to its unique structural characteristics. As with many organic compounds, it is essential to handle it with care, considering safety data and potential hazards associated with its use.
Formula:C11H20O
InChI:InChI=1S/C11H20O/c12-9-10-3-7-11(8-4-10)5-1-2-6-11/h10,12H,1-9H2
InChI key:InChIKey=WXMHDMXIIBCNCP-UHFFFAOYSA-N
SMILES:C(O)C1CCC2(CC1)CCCC2
Synonyms:- [Spiro[4.5]decan-8-yl]methanol
- Spiro[4.5]decane-8-methanol
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.