CAS 108238-09-1

(2-Phenoxy)phenylboronic acid

Description:

(2-Phenoxy)phenylboronic acid is an organoboron compound characterized by the presence of both a boronic acid functional group and a phenoxy substituent. It typically appears as a white to off-white solid and is soluble in polar organic solvents. This compound features a boron atom bonded to a phenyl group and a phenoxy group, which contributes to its unique reactivity and potential applications in organic synthesis and medicinal chemistry. The boronic acid moiety allows for reversible covalent bonding with diols, making it useful in various chemical reactions, including Suzuki coupling reactions, which are pivotal in forming carbon-carbon bonds. Additionally, (2-Phenoxy)phenylboronic acid may exhibit biological activity, making it of interest in drug development and materials science. Its properties, such as melting point, boiling point, and stability, can vary based on environmental conditions and the presence of other functional groups. Proper handling and storage are essential due to its reactivity and potential hazards associated with boron compounds.

Formula: C₁₂H₁₁BO₃

InChI: InChI=1/C12H11BO3/c14-13(15)11-8-4-5-9-12(11)16-10-6-2-1-3-7-10/h1-9,14-15H

SMILES: c1ccc(cc1)Oc1ccccc1B(O)O

Synonyms:

• 2-Phenoxyphenylboronic Acid
• 2-Phenoxybenzeneboronic acid

2-Phenoxybenzeneboronic acid, 98%

CAS: 108238-09-1

Reactant for palladium catalyzed cross-coupling reactions, trifluoromethylation via copper-mediated oxidative cross-coupling, preparation of biologically and pharmacologically active molecules, preparation of pyridazine-based scaffolds as a-helix mimetics. This Thermo Scientific Chemicals brand pro

Formula: C₁₂H₁₁BO₃

Purity: 98%

Color and Shape: White, Powder

Molecular weight: 214.03

Ref: 02-H53264

2-Phenoxybenzeneboronic acid

CAS: 108238-09-1

Formula: C₁₂H₁₁BO₃

Purity: 98%

Color and Shape: Solid

Molecular weight: 214.0249

Ref: IN-DA0083VM

2-Phenoxyphenylboronic Acid (contains varying amounts of Anhydride)

CAS: 108238-09-1

Formula: C₁₂H₁₁BO₃

Color and Shape: White to Almost white powder to crystal

Molecular weight: 214.03

Ref: 3B-P2539

2-Phenoxybenzeneboronic acid

CAS: 108238-09-1

2-Phenoxybenzeneboronic acid

Purity: 99%

Molecular weight: 214.02494g/mol

Ref: 54-OR10577

2-Phenoxybenzeneboronic acid

CAS: 108238-09-1

Formula: C₁₂H₁₁BO₃

Purity: 97%

Color and Shape: Solid

Molecular weight: 214.03

Ref: 10-F065575