CymitQuimica logo

CAS 108238-10-4

:

2-(Bromomethyl)-1-methylnaphthalene

Description:
2-(Bromomethyl)-1-methylnaphthalene is an organic compound characterized by its naphthalene backbone, which consists of two fused aromatic rings. The presence of a bromomethyl group (-CH2Br) at the 2-position and a methyl group (-CH3) at the 1-position of the naphthalene structure contributes to its unique chemical properties. This compound is typically a colorless to pale yellow liquid or solid, depending on its purity and temperature. It is known for its reactivity due to the bromine atom, which can participate in various substitution reactions, making it useful in organic synthesis. The compound may exhibit moderate to low solubility in water but is generally soluble in organic solvents such as ethanol, ether, and chloroform. Its applications can include use as an intermediate in the synthesis of pharmaceuticals, agrochemicals, and other organic compounds. Safety precautions should be taken when handling this substance, as it may pose health risks due to its bromine content and potential toxicity.
Formula:C12H11Br
InChI:InChI=1S/C12H11Br/c1-9-11(8-13)7-6-10-4-2-3-5-12(9)10/h2-7H,8H2,1H3
InChI key:InChIKey=GANBSOXQWLYXOE-UHFFFAOYSA-N
SMILES:CC=1C2=C(C=CC1CBr)C=CC=C2
Synonyms:
  • Naphthalene, 2-(bromomethyl)-1-methyl-
  • 2-(Bromomethyl)-1-methylnaphthalene
Sort by

The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.