
CAS 1082399-00-5
:4-(2,5-Dimethyl-4-oxazolyl)benzenesulfonyl chloride
Description:
4-(2,5-Dimethyl-4-oxazolyl)benzenesulfonyl chloride is a chemical compound characterized by its sulfonyl chloride functional group, which is known for its reactivity and ability to form sulfonamides. This compound features a benzene ring substituted with a 2,5-dimethyl-4-oxazolyl group, contributing to its unique properties. The presence of the oxazole ring introduces heteroatoms, which can influence the compound's reactivity and solubility. As a sulfonyl chloride, it is typically used as a reagent in organic synthesis, particularly for the introduction of sulfonyl groups into various substrates. The compound is likely to be a solid at room temperature and may exhibit moderate to high stability under dry conditions, but it can be sensitive to moisture, leading to hydrolysis and the release of hydrochloric acid. Safety precautions are essential when handling this compound due to its corrosive nature and potential to cause irritation. Overall, its unique structure and functional groups make it valuable in synthetic organic chemistry.
Formula:C11H10ClNO3S
InChI:InChI=1S/C11H10ClNO3S/c1-7-11(13-8(2)16-7)9-3-5-10(6-4-9)17(12,14)15/h3-6H,1-2H3
InChI key:InChIKey=DJUCKCOHCPVGJA-UHFFFAOYSA-N
SMILES:CC1=C(N=C(C)O1)C2=CC=C(S(Cl)(=O)=O)C=C2
Synonyms:- 4-(2,5-Dimethyl-4-oxazolyl)benzenesulfonyl chloride
- Benzenesulfonyl chloride, 4-(2,5-dimethyl-4-oxazolyl)-
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.