
CAS 1082399-75-4
:1-(Aminomethyl)-2,3-dihydro-6-(1-methylethyl)-1H-inden-1-ol
Description:
1-(Aminomethyl)-2,3-dihydro-6-(1-methylethyl)-1H-inden-1-ol, identified by its CAS number 1082399-75-4, is a chemical compound characterized by its unique structure that includes an indene core with an amino group and a hydroxyl group. This compound typically exhibits properties associated with both amines and alcohols, such as potential solubility in polar solvents and the ability to participate in hydrogen bonding. The presence of the isopropyl group contributes to its hydrophobic characteristics, influencing its overall reactivity and interaction with other molecules. It may be of interest in various fields, including medicinal chemistry and materials science, due to its potential biological activity and functional properties. As with many organic compounds, its stability and reactivity can be influenced by environmental factors such as pH and temperature. Safety data should be consulted for handling and usage, as the presence of amine and alcohol functional groups can impart specific hazards.
Formula:C13H19NO
InChI:InChI=1S/C13H19NO/c1-9(2)11-4-3-10-5-6-13(15,8-14)12(10)7-11/h3-4,7,9,15H,5-6,8,14H2,1-2H3
InChI key:InChIKey=CETQGMYRHXFPPU-UHFFFAOYSA-N
SMILES:C(N)C1(O)C=2C(CC1)=CC=C(C(C)C)C2
Synonyms:- 1-(Aminomethyl)-2,3-dihydro-6-(1-methylethyl)-1H-inden-1-ol
- 1H-Inden-1-ol, 1-(aminomethyl)-2,3-dihydro-6-(1-methylethyl)-
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.