CymitQuimica logo

CAS 1082399-77-6

:

1-(Aminomethyl)-2,3-dihydro-4,6-dimethoxy-1H-inden-1-ol

Description:
1-(Aminomethyl)-2,3-dihydro-4,6-dimethoxy-1H-inden-1-ol, identified by its CAS number 1082399-77-6, is a chemical compound characterized by its unique structural features, including an indene core with multiple functional groups. This compound contains an amino group, which contributes to its potential as a building block in organic synthesis and medicinal chemistry. The presence of methoxy groups enhances its solubility and reactivity, making it suitable for various chemical reactions. Additionally, the dihydro form indicates that it has a saturated structure, which may influence its stability and reactivity compared to unsaturated analogs. The hydroxyl group (alcohol) further adds to its reactivity, allowing for hydrogen bonding and participation in various chemical transformations. Overall, this compound's distinctive structure and functional groups suggest potential applications in pharmaceuticals, agrochemicals, or as intermediates in organic synthesis, although specific applications would depend on further research and development.
Formula:C12H17NO3
InChI:InChI=1S/C12H17NO3/c1-15-8-5-10-9(11(6-8)16-2)3-4-12(10,14)7-13/h5-6,14H,3-4,7,13H2,1-2H3
InChI key:InChIKey=FMDGNORLVGOKSX-UHFFFAOYSA-N
SMILES:C(N)C1(O)C=2C(=C(OC)C=C(OC)C2)CC1
Synonyms:
  • 1-(Aminomethyl)-2,3-dihydro-4,6-dimethoxy-1H-inden-1-ol
  • 1H-Inden-1-ol, 1-(aminomethyl)-2,3-dihydro-4,6-dimethoxy-
Sort by

The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.