CAS 108241-00-5

2-[2-[4-(1,1,3,3-Tetramethylbutyl)phenoxy]ethoxy]acetic acid

Description:

2-[2-[4-(1,1,3,3-Tetramethylbutyl)phenoxy]ethoxy]acetic acid, with CAS number 108241-00-5, is a chemical compound characterized by its complex structure, which includes a phenoxy group and an acetic acid moiety. This substance is typically used as a surfactant or emulsifier due to its amphiphilic nature, allowing it to interact with both hydrophilic and hydrophobic substances. The presence of the bulky tetramethylbutyl group contributes to its hydrophobic characteristics, enhancing its effectiveness in various applications, including formulations in agricultural and industrial products. Additionally, the ethoxy linkages provide flexibility and solubility in organic solvents. The compound's stability and performance can be influenced by factors such as pH and temperature, making it suitable for diverse environments. Safety data should be consulted for handling and exposure guidelines, as with any chemical substance. Overall, this compound exemplifies the intricate balance of hydrophilic and hydrophobic properties that are essential for effective surfactants in various applications.

Formula: C₁₈H₂₈O₄

InChI: InChI=1S/C18H28O4/c1-17(2,3)13-18(4,5)14-6-8-15(9-7-14)22-11-10-21-12-16(19)20/h6-9H,10-13H2,1-5H3,(H,19,20)

InChI key: InChIKey=OIIJTXDGYXEQHS-UHFFFAOYSA-N

SMILES: C(CC(C)(C)C)(C)(C)C1=CC=C(OCCOCC(O)=O)C=C1

Synonyms:

• Acetic acid, [2-(p-1,1,3,3-tetramethylbutylphenoxy)ethoxy]-
• Acetic acid, [2-[4-(1,1,3,3-tetramethylbutyl)phenoxy]ethoxy]-
• Acetic acid, 2-[2-[4-(1,1,3,3-tetramethylbutyl)phenoxy]ethoxy]-
• 2-[2-[4-(1,1,3,3-Tetramethylbutyl)phenoxy]ethoxy]acetic acid