CAS 1082435-14-0

2-Methoxy-5-methylbenzenebutanal

Description:

2-Methoxy-5-methylbenzenebutanal, identified by its CAS number 1082435-14-0, is an organic compound characterized by its aromatic structure and functional groups. It features a methoxy group (-OCH3) and a butanal chain, which contribute to its reactivity and potential applications in organic synthesis. The presence of the methyl group on the benzene ring enhances its hydrophobic characteristics, while the methoxy group can participate in various chemical reactions, including nucleophilic substitutions and electrophilic aromatic substitutions. This compound may exhibit moderate volatility and solubility in organic solvents, making it suitable for use in various chemical processes. Its structural features suggest potential applications in the fragrance industry, as well as in the synthesis of more complex organic molecules. Additionally, the compound's properties may be influenced by factors such as temperature and solvent choice, which can affect its stability and reactivity. Overall, 2-Methoxy-5-methylbenzenebutanal represents a versatile building block in organic chemistry.

Formula: C₁₂H₁₆O₂

InChI: InChI=1S/C12H16O2/c1-10-6-7-12(14-2)11(9-10)5-3-4-8-13/h6-9H,3-5H2,1-2H3

InChI key: InChIKey=YAUBPMLLDMFGNQ-UHFFFAOYSA-N

SMILES: C(CCC=O)C1=C(OC)C=CC(C)=C1

Synonyms:

• 2-Methoxy-5-methylbenzenebutanal
• Benzenebutanal, 2-methoxy-5-methyl-