CymitQuimica logo

CAS 1082436-87-0

:

3-(3,5-Dimethylphenyl)-3,6-dihydro-7H-1,2,3-triazolo[4,5-d]pyrimidin-7-one

Description:
3-(3,5-Dimethylphenyl)-3,6-dihydro-7H-1,2,3-triazolo[4,5-d]pyrimidin-7-one is a heterocyclic compound characterized by its complex structure, which includes a triazole and pyrimidine moiety. This compound typically exhibits a range of biological activities, making it of interest in medicinal chemistry. Its molecular framework suggests potential interactions with biological targets, which may lead to pharmacological effects. The presence of the 3,5-dimethylphenyl group contributes to its lipophilicity, potentially influencing its absorption and distribution in biological systems. Additionally, the triazole ring can participate in hydrogen bonding and coordination with metal ions, which may enhance its reactivity and biological activity. The compound is likely to be soluble in organic solvents, and its stability can be influenced by environmental factors such as pH and temperature. Overall, this substance represents a class of compounds that may have applications in drug development and therapeutic interventions, although specific biological activities would require empirical investigation.
Formula:C12H11N5O
InChI:InChI=1S/C12H11N5O/c1-7-3-8(2)5-9(4-7)17-11-10(15-16-17)12(18)14-6-13-11/h3-6H,1-2H3,(H,13,14,18)
InChI key:InChIKey=CDNMAMWIACYRBZ-UHFFFAOYSA-N
SMILES:O=C1C2=C(N(N=N2)C3=CC(C)=CC(C)=C3)NC=N1
Synonyms:
  • 7H-1,2,3-Triazolo[4,5-d]pyrimidin-7-one, 3-(3,5-dimethylphenyl)-3,6-dihydro-
  • 3-(3,5-Dimethylphenyl)-3,6-dihydro-7H-1,2,3-triazolo[4,5-d]pyrimidin-7-one
Sort by

The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.