CAS 1082454-50-9

Piperazine, 1-[3-[(4-fluorophenyl)methoxy]phenyl]-

Description:

Piperazine, 1-[3-[(4-fluorophenyl)methoxy]phenyl]- is a chemical compound characterized by its piperazine core, which is a six-membered ring containing two nitrogen atoms. This compound features a phenyl group substituted with a methoxy group and a fluorine atom, contributing to its unique properties. The presence of the fluorophenyl moiety enhances its lipophilicity and may influence its biological activity. Typically, compounds of this nature are investigated for their potential pharmacological applications, including roles as anxiolytics, antidepressants, or in other therapeutic areas. The molecular structure suggests potential interactions with various biological targets, making it a subject of interest in medicinal chemistry. Additionally, the compound's solubility, stability, and reactivity can be influenced by the functional groups present, which are critical for its application in drug development. As with many piperazine derivatives, understanding its pharmacokinetics and pharmacodynamics is essential for evaluating its efficacy and safety in potential therapeutic uses.

Formula: C₁₇H₁₉FN₂O

InChI: InChI=1S/C17H19FN2O/c18-15-6-4-14(5-7-15)13-21-17-3-1-2-16(12-17)20-10-8-19-9-11-20/h1-7,12,19H,8-11,13H2

InChI key: InChIKey=LEYOXRMNSMTSHV-UHFFFAOYSA-N

SMILES: O(CC1=CC=C(F)C=C1)C=2C=C(C=CC2)N3CCNCC3

Synonyms:

• Piperazine, 1-[3-[(4-fluorophenyl)methoxy]phenyl]-

1-{3-[(4-Fluorophenyl)methoxy]phenyl}piperazine

CAS: 1082454-50-9

Versatile small molecule scaffold

Formula: C₁₇H₁₉FN₂O

Purity: Min. 95%

Molecular weight: 286.34 g/mol

Ref: 3D-HTB45450