CAS 108248-08-4

N-methyl-N-(2-methylpropyl)-1,3-benzodioxol-5-amine

Description:

N-methyl-N-(2-methylpropyl)-1,3-benzodioxol-5-amine, identified by its CAS number 108248-08-4, is a chemical compound that belongs to the class of substituted amines. This substance features a benzodioxole core, which is characterized by a fused dioxole ring and a benzene ring, contributing to its unique structural properties. The presence of the N-methyl and N-(2-methylpropyl) substituents indicates that it has both methyl and branched alkyl groups attached to the nitrogen atom, which can influence its solubility and reactivity. Compounds of this nature may exhibit biological activity, potentially interacting with various receptors or enzymes in biological systems. The specific characteristics, such as melting point, boiling point, and solubility, would depend on the molecular interactions and the overall structure. As with many organic compounds, safety data and handling precautions are essential, particularly regarding toxicity and environmental impact. Further studies would be necessary to fully elucidate its properties and potential applications in fields such as pharmaceuticals or materials science.

Formula: C₁₂H₁₇NO₂

InChI: InChI=1/C12H17NO2/c1-9(2)7-13(3)10-4-5-11-12(6-10)15-8-14-11/h4-6,9H,7-8H2,1-3H3

SMILES: CC(C)CN(C)c1ccc2c(c1)OCO2