CAS 1082584-11-9

1-(3-Chloro-4-fluorophenyl)-1,5-dihydro-4H-pyrazolo[3,4-d]pyrimidin-4-one

Description:

1-(3-Chloro-4-fluorophenyl)-1,5-dihydro-4H-pyrazolo[3,4-d]pyrimidin-4-one is a chemical compound characterized by its complex heterocyclic structure, which includes a pyrazolo-pyrimidine framework. This compound features a chloro and a fluorine substituent on the phenyl ring, contributing to its unique chemical reactivity and potential biological activity. The presence of the pyrazolo and pyrimidine moieties suggests that it may exhibit properties relevant to medicinal chemistry, possibly acting as a scaffold for drug development. Its molecular structure indicates potential interactions with biological targets, making it of interest in pharmacological research. The compound's solubility, stability, and reactivity would depend on the specific functional groups and their positions within the molecule. Additionally, the presence of halogens like chlorine and fluorine can influence lipophilicity and metabolic stability, which are critical factors in drug design. Overall, this compound represents a class of heterocycles that may have applications in various fields, including pharmaceuticals and agrochemicals.

Formula: C₁₁H₆ClFN₄O

InChI: InChI=1S/C11H6ClFN4O/c12-8-3-6(1-2-9(8)13)17-10-7(4-16-17)11(18)15-5-14-10/h1-5H,(H,14,15,18)

InChI key: InChIKey=HLCGUDLKMOVPRZ-UHFFFAOYSA-N

SMILES: O=C1C2=C(N(N=C2)C3=CC(Cl)=C(F)C=C3)NC=N1

Synonyms:

• 4H-Pyrazolo[3,4-d]pyrimidin-4-one, 1-(3-chloro-4-fluorophenyl)-1,5-dihydro-
• 1-(3-Chloro-4-fluorophenyl)-1,5-dihydro-4H-pyrazolo[3,4-d]pyrimidin-4-one