CAS 1082604-63-4
:4-(6-Chloroimidazo[1,2-b]pyridazin-3-yl)benzonitrile
Description:
4-(6-Chloroimidazo[1,2-b]pyridazin-3-yl)benzonitrile is a chemical compound characterized by its complex structure, which includes an imidazo[1,2-b]pyridazine moiety and a benzonitrile group. This compound features a chloro substituent at the 6-position of the imidazo ring, contributing to its unique reactivity and potential biological activity. The presence of the benzonitrile group indicates that it may exhibit properties typical of nitriles, such as being polar and capable of participating in various chemical reactions, including nucleophilic additions. The compound is likely to be a solid at room temperature, with potential applications in medicinal chemistry, particularly in the development of pharmaceuticals targeting specific biological pathways. Its structural complexity suggests that it may interact with biological targets through multiple mechanisms, making it a candidate for further research in drug discovery. As with many synthetic organic compounds, safety and handling precautions should be observed due to potential toxicity or reactivity.
Formula:C13H7ClN4
InChI:InChI=1S/C13H7ClN4/c14-12-5-6-13-16-8-11(18(13)17-12)10-3-1-9(7-15)2-4-10/h1-6,8H
InChI key:InChIKey=XEVRTNQTEZIXOW-UHFFFAOYSA-N
SMILES:ClC1=NN2C(=CN=C2C=C1)C3=CC=C(C#N)C=C3
Synonyms:- Benzonitrile, 4-(6-chloroimidazo[1,2-b]pyridazin-3-yl)-
- 4-(6-Chloroimidazo[1,2-b]pyridazin-3-yl)benzonitrile
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.