CAS 1082745-58-1

5-Amino-1-cyclobutyl-1H-pyrazole-4-carbonitrile

Description:

5-Amino-1-cyclobutyl-1H-pyrazole-4-carbonitrile is a chemical compound characterized by its unique structural features, which include a pyrazole ring, an amino group, and a carbonitrile functional group. The presence of the cyclobutyl group contributes to its cyclic structure, influencing its physical and chemical properties. This compound is typically a solid at room temperature and may exhibit moderate solubility in polar solvents due to the presence of the amino and carbonitrile groups, which can engage in hydrogen bonding. Its molecular structure suggests potential biological activity, making it of interest in pharmaceutical research, particularly in the development of novel therapeutic agents. The compound's reactivity can be attributed to the functional groups present, allowing for various chemical transformations. Additionally, its stability under standard conditions is an important characteristic for practical applications. Overall, 5-Amino-1-cyclobutyl-1H-pyrazole-4-carbonitrile represents a class of compounds that may have significant implications in medicinal chemistry and related fields.

Formula: C₈H₁₀N₄

InChI: InChI=1S/C8H10N4/c9-4-6-5-11-12(8(6)10)7-2-1-3-7/h5,7H,1-3,10H2

InChI key: InChIKey=NXWXJURPEMJOOP-UHFFFAOYSA-N

SMILES: NC=1N(N=CC1C#N)C2CCC2

Synonyms:

• 5-Amino-1-cyclobutyl-1H-pyrazole-4-carbonitrile
• 1H-Pyrazole-4-carbonitrile, 5-amino-1-cyclobutyl-