CAS 1082766-13-9
:2-Fluoro-5-(4H-1,2,4-triazol-4-yl)benzenamine
Description:
2-Fluoro-5-(4H-1,2,4-triazol-4-yl)benzenamine is an organic compound characterized by the presence of a fluorine atom and a triazole ring attached to a benzeneamine structure. The compound features a fluorobenzene moiety, which contributes to its potential reactivity and solubility properties. The triazole ring, a five-membered heterocyclic structure containing three nitrogen atoms, is known for its biological activity and is often found in pharmaceuticals and agrochemicals. This compound may exhibit various properties such as moderate to high polarity due to the presence of the amino group and the electronegative fluorine atom, which can influence its interaction with biological targets. Additionally, the presence of the triazole moiety may enhance its ability to form hydrogen bonds, potentially affecting its pharmacokinetic and pharmacodynamic profiles. Overall, 2-Fluoro-5-(4H-1,2,4-triazol-4-yl)benzenamine is of interest in medicinal chemistry and material science due to its unique structural features and potential applications.
Formula:C8H7FN4
InChI:InChI=1S/C8H7FN4/c9-7-2-1-6(3-8(7)10)13-4-11-12-5-13/h1-5H,10H2
InChI key:InChIKey=WXILGCWARVMDQB-UHFFFAOYSA-N
SMILES:NC=1C=C(C=CC1F)N2C=NN=C2
Synonyms:- 2-Fluoro-5-(4H-1,2,4-triazol-4-yl)benzenamine
- Benzenamine, 2-fluoro-5-(4H-1,2,4-triazol-4-yl)-
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 1 products.
