CAS 1082766-46-8
:3-[[(2-Methylphenyl)methyl]thio]-1-propanamine
Description:
3-[[(2-Methylphenyl)methyl]thio]-1-propanamine, identified by its CAS number 1082766-46-8, is an organic compound characterized by its unique structure, which includes a propanamine backbone with a thioether functional group. The presence of the 2-methylphenyl group contributes to its hydrophobic characteristics, while the amine group provides basicity and potential for hydrogen bonding. This compound may exhibit moderate solubility in organic solvents and limited solubility in water due to its hydrophobic aromatic component. Its thioether linkage can influence its reactivity, potentially making it a candidate for various chemical reactions, including nucleophilic substitutions. The compound's biological activity may also be of interest, as amines often play significant roles in pharmacology and biochemistry. However, specific data regarding its toxicity, stability, and applications may require further investigation through experimental studies or literature reviews. Overall, this compound represents a class of organic molecules that could have implications in medicinal chemistry and material science.
Formula:C11H17NS
InChI:InChI=1S/C11H17NS/c1-10-5-2-3-6-11(10)9-13-8-4-7-12/h2-3,5-6H,4,7-9,12H2,1H3
InChI key:InChIKey=VIASPJFUAUDJGB-UHFFFAOYSA-N
SMILES:C(SCCCN)C1=C(C)C=CC=C1
Synonyms:- 1-Propanamine, 3-[[(2-methylphenyl)methyl]thio]-
- 3-[[(2-Methylphenyl)methyl]thio]-1-propanamine
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.