CAS 1082766-55-9: 2-Ethyl-5-(4H-1,2,4-triazol-4-yl)benzenamine

Description: 2-Ethyl-5-(4H-1,2,4-triazol-4-yl)benzenamine is an organic compound characterized by its aromatic structure, which includes a benzene ring substituted with an ethyl group and an amino group, as well as a triazole moiety. The presence of the triazole ring, a five-membered heterocyclic compound containing three nitrogen atoms, imparts unique chemical properties, including potential biological activity. This compound may exhibit properties such as solubility in organic solvents and moderate stability under standard conditions. Its functional groups suggest potential applications in pharmaceuticals, particularly in the development of antifungal or antimicrobial agents, due to the triazole's known efficacy in these areas. Additionally, the amino group can participate in hydrogen bonding, influencing the compound's reactivity and interactions with other molecules. Overall, 2-Ethyl-5-(4H-1,2,4-triazol-4-yl)benzenamine represents a versatile structure with implications in medicinal chemistry and material science.

Formula: C₁₀H₁₂N₄

InChI: InChI=1S/C10H12N4/c1-2-8-3-4-9(5-10(8)11)14-6-12-13-7-14/h3-7H,2,11H2,1H3

InChI key: InChIKey=SHWFGFCIZCLHTA-UHFFFAOYSA-N

SMILES: N=1N=CN(C1)C2=CC=C(C(N)=C2)CC

2-ethyl-5-(4H-1,2,4-triazol-4-yl)aniline

CAS: 1082766-55-9

• Purity: 95.0%
• Molecular weight: 188.23399353027344

2-Ethyl-5-(4H-1,2,4-triazol-4-yl)aniline

CAS: 1082766-55-9

Versatile small molecule scaffold

• Formula: C₁₀H₁₂N₄
• Purity: Min. 95%
• Molecular weight: 188.23 g/mol