CAS 1082806-61-8

3-(1,3-Benzodioxol-5-yl)pyrrolidine

Description:

3-(1,3-Benzodioxol-5-yl)pyrrolidine is a chemical compound characterized by its unique structure, which includes a pyrrolidine ring fused with a benzodioxole moiety. This compound typically exhibits properties associated with both heterocyclic and aromatic compounds, contributing to its potential biological activity. The presence of the benzodioxole group may impart certain pharmacological properties, making it of interest in medicinal chemistry. It is generally soluble in organic solvents, and its stability can be influenced by environmental factors such as pH and temperature. The compound's molecular interactions may involve hydrogen bonding and π-π stacking due to its aromatic nature. As with many organic compounds, its reactivity can be influenced by substituents on the benzodioxole and pyrrolidine rings, which may affect its synthesis and potential applications. Research into this compound may focus on its role in drug development, particularly in areas related to neurochemistry or as a potential therapeutic agent. However, specific biological activities and safety profiles would require further investigation through empirical studies.

Formula: C₁₁H₁₃NO₂

InChI: InChI=1S/C11H13NO2/c1-2-10-11(14-7-13-10)5-8(1)9-3-4-12-6-9/h1-2,5,9,12H,3-4,6-7H2

InChI key: InChIKey=HZVSXGNTMOKANQ-UHFFFAOYSA-N

SMILES: C=1(C=C2C(=CC1)OCO2)C3CCNC3

Synonyms:

• Pyrrolidine, 3-(1,3-benzodioxol-5-yl)-
• 3-(1,3-Benzodioxol-5-yl)pyrrolidine

3-(benzo[d][1,3]dioxol-5-yl)pyrrolidine

CAS: 1082806-61-8

Purity: 95.0%

Molecular weight: 191.22999572753906

Ref: 10-F495734