CAS 108282-38-8
:4-Amino-5-chloro-2-ethoxybenzoic acid
Description:
4-Amino-5-chloro-2-ethoxybenzoic acid is an organic compound characterized by its aromatic structure, which includes a benzoic acid moiety substituted with an amino group, a chloro group, and an ethoxy group. The presence of the amino group (-NH2) indicates that it can act as a weak base, while the carboxylic acid group (-COOH) contributes to its acidic properties. The chloro substituent enhances the compound's reactivity and can influence its biological activity. The ethoxy group (-OCH2CH3) adds steric bulk and can affect solubility and lipophilicity. This compound is typically used in pharmaceutical research and development, particularly in the synthesis of various biologically active molecules. Its properties, such as melting point, solubility, and reactivity, can vary based on the specific conditions and solvents used. Safety data should be consulted for handling, as with any chemical substance, to ensure proper precautions are taken during use.
Formula:C9H10ClNO3
InChI:InChI=1S/C9H10ClNO3/c1-2-14-8-4-7(11)6(10)3-5(8)9(12)13/h3-4H,2,11H2,1H3,(H,12,13)
InChI key:InChIKey=XWGYOMHQGQZRLC-UHFFFAOYSA-N
SMILES:C(O)(=O)C1=C(OCC)C=C(N)C(Cl)=C1
Synonyms:- 2-Ethoxy-4-amino-5-chlorobenzoic acid
- 4-Amino-5-chloro-2-ethoxy-benzoic acid
- 4-Amino-5-cholro-2-ethoxy-benzoic acid
- 4-Amino-5-choro-2-ethyoxybenzic acid
- 4-Amino-5-choro-2-ethyoxybenzoic acid
- Benzoic acid, 4-amino-5-chloro-2-ethoxy-
- 4-Amino-5-chloro-2-ethoxybenzoic acid
Sort by
Purity (%)
0
100
|
0
|
50
|
90
|
95
|
100
Found 6 products.
4-Amino-5-chloro-2-ethoxybenzoic Acid
CAS:Formula:C9H10ClNO3Purity:>98.0%(T)(HPLC)Color and Shape:White to Almost white powder to crystalMolecular weight:215.634-Amino-5-chloro-2-ethoxybenzoic acid
CAS:Formula:C9H10ClNO3Purity:98%Color and Shape:SolidMolecular weight:215.63364-Amino-5-chloro-2-ethoxybenzoic acid
CAS:4-Amino-5-chloro-2-ethoxybenzoic acidPurity:98%Molecular weight:215.63g/mol4-Amino-5-chloro-2-ethoxybenzoic acid
CAS:4-Amino-5-chloro-2-ethoxybenzoic acid is a phenoxy compound that is synthesized in the laboratory. The chemical structure of this compound has been studied using high performance liquid chromatography and it was found to have pharmacokinetic properties that are consistent with those of other drugs in its class. This drug is being developed as an anti-depressant, targeting the 5HT4 receptor. The bioactive metabolite of 4-amino-5-chloro-2-ethoxybenzoic acid is 4-(4′ hydroxybutyl)phenol, which has been shown to be a potent inhibitor of phosphodiesterase activity.
Formula:C9H10ClNO3Purity:Min. 95%Color and Shape:White Off-White PowderMolecular weight:215.63 g/mol4-Amino-5-chloro-2-ethoxybenzoic acid
CAS:Formula:C9H10ClNO3Purity:95%Color and Shape:SolidMolecular weight:215.634-Amino-5-chloro-2-ethoxybenzoic Acid
CAS:Controlled ProductApplications 4-Amino-5-chloro-2-ethoxybenzoic acid (cas# 108282-38-8) is a useful research chemical.
Formula:C9H10NO3ClColor and Shape:NeatMolecular weight:215.63





