CAS 1082847-64-0

5-Methylthiazolo[4,5-f]quinolin-2-amine

Description:

5-Methylthiazolo[4,5-f]quinolin-2-amine is a heterocyclic compound characterized by its unique structural features, which include a thiazole ring fused to a quinoline moiety. This compound typically exhibits properties associated with both thiazole and quinoline derivatives, such as potential biological activity and the ability to participate in various chemical reactions. It may possess a range of functional groups that can influence its solubility, reactivity, and interaction with biological targets. The presence of the methyl group on the thiazole ring can affect its electronic properties and steric hindrance, potentially enhancing its pharmacological profile. Compounds of this nature are often investigated for their potential applications in medicinal chemistry, particularly in the development of pharmaceuticals due to their ability to interact with biological systems. Additionally, the compound's stability, melting point, and solubility can vary based on environmental conditions and the presence of other chemical entities. Overall, 5-Methylthiazolo[4,5-f]quinolin-2-amine represents a class of compounds with significant interest in both synthetic and medicinal chemistry.

Formula: C₁₁H₉N₃S

InChI: InChI=1S/C11H9N3S/c1-6-5-8-10(14-11(12)15-8)7-3-2-4-13-9(6)7/h2-5H,1H3,(H2,12,14)

InChI key: InChIKey=GPJOICGGYSCBCY-UHFFFAOYSA-N

SMILES: NC1=NC=2C=3C(C(C)=CC2S1)=NC=CC3

Synonyms:

• 5-Methylthiazolo[4,5-f]quinolin-2-amine
• Thiazolo[4,5-f]quinolin-2-amine, 5-methyl-