CAS 1082859-17-3
:α-Methylimidazo[1,2-a]pyridine-2-methanamine
Description:
α-Methylimidazo[1,2-a]pyridine-2-methanamine, identified by its CAS number 1082859-17-3, is a heterocyclic organic compound characterized by its imidazo and pyridine ring structures. This compound features a methyl group at the alpha position of the imidazole ring and an amine functional group, which contributes to its reactivity and potential biological activity. It is typically a colorless to pale yellow solid, and its molecular structure suggests it may participate in various chemical reactions, including nucleophilic substitutions and electrophilic additions. The presence of the amine group indicates potential for hydrogen bonding, influencing its solubility and interaction with other molecules. Compounds of this class are often studied for their roles in biological systems, particularly in relation to mutagenicity and carcinogenicity, as they can be formed during the cooking of certain foods. Safety and handling precautions are essential due to potential toxicity, and further research is often necessary to fully understand its environmental and health impacts.
Formula:C9H11N3
InChI:InChI=1S/C9H11N3/c1-7(10)8-6-12-5-3-2-4-9(12)11-8/h2-7H,10H2,1H3
InChI key:InChIKey=JFYSCZFFBRGSBA-UHFFFAOYSA-N
SMILES:C(C)(N)C=1N=C2N(C1)C=CC=C2
Synonyms:- 1-Imidazo[1,2-a]pyridin-2-ylethanamine
- Imidazo[1,2-a]pyridine-2-methanamine, α-methyl-
- α-Methylimidazo[1,2-a]pyridine-2-methanamine
- 1-[Imidazo[1,2-a]pyridin-2-yl]ethan-1-amine
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.