CymitQuimica logo

CAS 1082871-90-6

:

1,3,4,6,7,11b-Hexahydro-10-methoxy-2H-pyrazino[2,1-a]isoquinoline

Description:
1,3,4,6,7,11b-Hexahydro-10-methoxy-2H-pyrazino[2,1-a]isoquinoline is a complex organic compound characterized by its unique bicyclic structure, which includes a pyrazinoisoquinoline framework. This compound features multiple saturated rings, contributing to its stability and potential biological activity. The presence of a methoxy group enhances its solubility and may influence its pharmacological properties. Typically, such compounds are of interest in medicinal chemistry due to their potential therapeutic applications, including neuroactive or anti-inflammatory effects. The molecular structure suggests that it may interact with various biological targets, making it a candidate for further research in drug development. Additionally, its specific stereochemistry and functional groups can significantly affect its reactivity and interactions with other molecules. As with many organic compounds, understanding its characteristics requires consideration of its physical properties, such as melting point, solubility, and spectral data, which are essential for determining its behavior in different environments and applications.
Formula:C13H18N2O
InChI:InChI=1S/C13H18N2O/c1-16-11-3-2-10-4-6-15-7-5-14-9-13(15)12(10)8-11/h2-3,8,13-14H,4-7,9H2,1H3
InChI key:InChIKey=OVPXDHPMDMRHSY-UHFFFAOYSA-N
SMILES:O(C)C=1C=C2C3N(CCC2=CC1)CCNC3
Synonyms:
  • 10-Methoxy-2,3,4,6,7,11b-hexahydro-1H-pyrazino[2,1-a]isoquinoline
  • 1,3,4,6,7,11b-Hexahydro-10-methoxy-2H-pyrazino[2,1-a]isoquinoline
  • 2H-Pyrazino[2,1-a]isoquinoline, 1,3,4,6,7,11b-hexahydro-10-methoxy-
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 1 products.