CAS 1082881-60-4

3-(3-Ethoxyphenyl)pyrrolidine

Description:

3-(3-Ethoxyphenyl)pyrrolidine is an organic compound characterized by its pyrrolidine ring, which is a five-membered nitrogen-containing heterocycle. The structure features a phenyl group substituted with an ethoxy group at the para position relative to the nitrogen atom of the pyrrolidine. This compound is typically classified as an amine due to the presence of the nitrogen atom in the pyrrolidine ring. Its molecular structure suggests potential applications in medicinal chemistry, particularly in the development of pharmaceuticals, due to the presence of both aromatic and aliphatic components that can influence biological activity. The ethoxy group may enhance solubility and bioavailability, while the pyrrolidine moiety can contribute to the compound's ability to interact with biological targets. As with many organic compounds, its properties, such as solubility, melting point, and reactivity, can vary based on environmental conditions and the presence of other functional groups. Safety and handling precautions should be observed, as with all chemical substances, particularly in laboratory settings.

Formula: C₁₂H₁₇NO

InChI: InChI=1S/C12H17NO/c1-2-14-12-5-3-4-10(8-12)11-6-7-13-9-11/h3-5,8,11,13H,2,6-7,9H2,1H3

InChI key: InChIKey=FXADNCSEGSPDAP-UHFFFAOYSA-N

SMILES: O(CC)C=1C=C(C=CC1)C2CCNC2

Synonyms:

• Pyrrolidine, 3-(3-ethoxyphenyl)-
• 3-(3-Ethoxyphenyl)pyrrolidine