CymitQuimica logo

CAS 1082914-63-3

:

10-Chloro-1,2,3,6,7,11b-hexahydro-4H-pyrazino[2,1-a]isoquinolin-4-one

Description:
10-Chloro-1,2,3,6,7,11b-hexahydro-4H-pyrazino[2,1-a]isoquinolin-4-one is a chemical compound characterized by its complex bicyclic structure, which includes a pyrazinoisoquinoline framework. This compound features a chlorine atom at the 10-position, contributing to its reactivity and potential biological activity. The hexahydro configuration indicates that it contains multiple saturated carbon rings, which can influence its physical properties, such as solubility and stability. The presence of a carbonyl group (ketone) at the 4-position is significant for its chemical reactivity and potential interactions in biological systems. This compound may exhibit pharmacological properties, making it of interest in medicinal chemistry. Its specific characteristics, such as melting point, boiling point, and solubility, would depend on the molecular interactions and the environment in which it is studied. Overall, 10-Chloro-1,2,3,6,7,11b-hexahydro-4H-pyrazino[2,1-a]isoquinolin-4-one represents a unique structure that may have applications in drug development and research.
Formula:C12H13ClN2O
InChI:InChI=1S/C12H13ClN2O/c13-9-2-1-8-3-4-15-11(10(8)5-9)6-14-7-12(15)16/h1-2,5,11,14H,3-4,6-7H2
InChI key:InChIKey=SJUKXIIPHVWLHX-UHFFFAOYSA-N
SMILES:ClC=1C=C2C3N(CCC2=CC1)C(=O)CNC3
Synonyms:
  • 4H-Pyrazino[2,1-a]isoquinolin-4-one, 10-chloro-1,2,3,6,7,11b-hexahydro-
  • 10-Chloro-1,2,3,6,7,11b-hexahydro-4H-pyrazino[2,1-a]isoquinolin-4-one
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 1 products.