CymitQuimica logo

CAS 1082914-74-6

:

10-Chloro-1,3,4,6,7,11b-hexahydro-2H-pyrazino[2,1-a]isoquinoline

Description:
10-Chloro-1,3,4,6,7,11b-hexahydro-2H-pyrazino[2,1-a]isoquinoline is a chemical compound characterized by its complex bicyclic structure, which includes a pyrazinoisoquinoline framework. This compound features a chlorine atom at the 10-position, contributing to its reactivity and potential biological activity. The hexahydro configuration indicates that the compound is saturated, which may influence its solubility and stability. The presence of nitrogen atoms in the pyrazino ring suggests potential interactions with biological targets, making it of interest in medicinal chemistry. Its molecular structure may allow for various functionalization, which can be explored for pharmacological applications. The compound's CAS number, 1082914-74-6, serves as a unique identifier for regulatory and research purposes. Overall, the characteristics of this compound suggest it may have unique properties that could be leveraged in drug development or other chemical applications, although specific biological activities and properties would require further investigation through experimental studies.
Formula:C12H15ClN2
InChI:InChI=1S/C12H15ClN2/c13-10-2-1-9-3-5-15-6-4-14-8-12(15)11(9)7-10/h1-2,7,12,14H,3-6,8H2
InChI key:InChIKey=YMLVBOQJDMYZKG-UHFFFAOYSA-N
SMILES:ClC=1C=C2C3N(CCC2=CC1)CCNC3
Synonyms:
  • 2H-Pyrazino[2,1-a]isoquinoline, 10-chloro-1,3,4,6,7,11b-hexahydro-
  • 10-Chloro-1,3,4,6,7,11b-hexahydro-2H-pyrazino[2,1-a]isoquinoline
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 1 products.