CymitQuimica logo

CAS 1082926-05-3

:

3-(2-Chloro-6-fluorophenyl)pyrrolidine

Description:
3-(2-Chloro-6-fluorophenyl)pyrrolidine is a chemical compound characterized by its pyrrolidine ring, which is a five-membered nitrogen-containing heterocycle. The presence of a 2-chloro-6-fluorophenyl group indicates that the compound has both chlorine and fluorine substituents on the aromatic ring, contributing to its unique chemical properties. This compound is typically classified as an organic intermediate and may exhibit biological activity, making it of interest in medicinal chemistry and drug development. Its molecular structure suggests potential interactions with biological targets due to the electron-withdrawing effects of the halogen substituents, which can influence the compound's reactivity and solubility. Additionally, the presence of the pyrrolidine moiety may enhance its ability to interact with various biological systems. As with many organic compounds, the specific characteristics such as melting point, boiling point, and solubility would depend on the compound's purity and the conditions under which it is measured. Safety data and handling precautions should be considered due to the presence of halogenated groups, which can pose environmental and health risks.
Formula:C10H11ClFN
InChI:InChI=1S/C10H11ClFN/c11-8-2-1-3-9(12)10(8)7-4-5-13-6-7/h1-3,7,13H,4-6H2
InChI key:InChIKey=GCQDLBKVNYXUQB-UHFFFAOYSA-N
SMILES:ClC1=C(C(F)=CC=C1)C2CCNC2
Synonyms:
  • 3-(2-Chloro-6-fluorophenyl)pyrrolidine
  • Pyrrolidine, 3-(2-chloro-6-fluorophenyl)-
Sort by

The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.