CymitQuimica logo

CAS 1082949-99-2

:

4-[[[2-[4-Fluoro-3-(trifluoromethyl)phenyl]-2-oxoethyl]amino]carbonyl]-1-piperidinecarboxylic acid tert-butyl ester

Description:
The chemical substance known as "4-[[[2-[4-Fluoro-3-(trifluoromethyl)phenyl]-2-oxoethyl]amino]carbonyl]-1-piperidinecarboxylic acid tert-butyl ester" is a complex organic compound characterized by its multi-functional groups and fluorinated aromatic structure. It features a piperidine ring, which contributes to its potential biological activity, and a tert-butyl ester group that enhances its lipophilicity, possibly influencing its pharmacokinetic properties. The presence of a fluorine atom and a trifluoromethyl group on the phenyl ring suggests increased metabolic stability and altered electronic properties, which can be advantageous in drug design. The compound also contains an amide linkage and a carbonyl group, indicating potential for hydrogen bonding and interactions with biological targets. Overall, this compound's unique structural features may confer specific reactivity and biological activity, making it of interest in medicinal chemistry and pharmaceutical research. Its CAS number, 1082949-99-2, allows for precise identification and retrieval of information regarding its properties and applications in scientific literature.
Formula:C20H24F4N2O4
InChI:InChI=1S/C20H24F4N2O4/c1-19(2,3)30-18(29)26-8-6-12(7-9-26)17(28)25-11-16(27)13-4-5-15(21)14(10-13)20(22,23)24/h4-5,10,12H,6-9,11H2,1-3H3,(H,25,28)
InChI key:QJMZCTXXDQBKAB-UHFFFAOYSA-N
SMILES:CC(C)(C)OC(=O)N1CCC(CC1)C(=O)NCC(=O)C2=CC(=C(C=C2)F)C(F)(F)F
Synonyms:
  • Tert-Butyl 4-(2-(4-Fluoro-3-(Trifluoromethyl)Phenyl)-2-Oxoethylcarbamoyl)Piperidine-1-Carboxylate
  • 1-Boc-4-(2-(4-fluoro-3-(trifluoroMethyl)phenyl)-2-oxoethylcarbaMoyl)piperidine
Found 4 products.