
CAS 1082951-20-9
:4-Piperidinecarbonitrile, 1-(phenylmethyl)-, hydrochloride (1:1)
Description:
4-Piperidinecarbonitrile, 1-(phenylmethyl)-, hydrochloride (1:1) is a chemical compound characterized by its piperidine ring structure, which is a six-membered saturated heterocycle containing one nitrogen atom. This compound features a phenylmethyl group attached to the piperidine nitrogen, contributing to its unique properties. As a hydrochloride salt, it is typically more soluble in water compared to its free base form, enhancing its utility in various applications, particularly in pharmaceuticals. The presence of the carbonitrile functional group indicates potential reactivity, making it a candidate for further chemical transformations. Its molecular structure suggests it may exhibit biological activity, which is often explored in drug development. The compound's CAS number, 1082951-20-9, allows for precise identification in chemical databases. Safety and handling precautions should be observed, as with many nitrogen-containing heterocycles, due to potential toxicity and reactivity. Overall, this compound is of interest in medicinal chemistry and may serve as a building block for more complex molecules.
Formula:C13H16N2·ClH
InChI:InChI=1S/C13H16N2.ClH/c14-10-12-6-8-15(9-7-12)11-13-4-2-1-3-5-13;/h1-5,12H,6-9,11H2;1H
InChI key:InChIKey=BYEOFNPDPILBQK-UHFFFAOYSA-N
SMILES:C(N1CCC(C#N)CC1)C2=CC=CC=C2.Cl
Synonyms:- 1-Benzylpiperidine-4-carbonitrile hydrochloride
- 4-Piperidinecarbonitrile, 1-(phenylmethyl)-, hydrochloride (1:1)
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 1 products.
