CAS 108299-45-2
:4,4'-[methanediylbis(oxy)]dianilinium dichloride
Description:
4,4'-[Methanediylbis(oxy)]dianilinium dichloride, also known by its CAS number 108299-45-2, is a chemical compound characterized by its structure, which features a central methanediyl group connected to two aniline units through ether linkages. This compound typically appears as a crystalline solid and is soluble in polar solvents due to its ionic nature, which is enhanced by the presence of dichloride ions. The presence of the anilinium groups suggests that it may exhibit properties such as basicity and potential for protonation, making it useful in various applications, including as a dye or in polymer chemistry. Its dichloride form indicates that it can participate in ionic interactions, which may influence its reactivity and stability. Additionally, the compound may exhibit interesting thermal and optical properties, making it a subject of interest in materials science. Safety data should be consulted for handling, as with any chemical substance, to ensure proper precautions are taken.
Formula:C13H16Cl2N2O2
InChI:InChI=1/C13H14N2O2.2ClH/c14-10-1-5-12(6-2-10)16-9-17-13-7-3-11(15)4-8-13;;/h1-8H,9,14-15H2;2*1H
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 1 products.
Aniline, 4,4'-(methylenedioxy)di-, dihydrochloride
CAS:Aniline, 4,4'-(methylenedioxy)di-, dihydrochloride is a bioactive chemical.Formula:C13H15ClN2O2Color and Shape:SolidMolecular weight:266.72
