CymitQuimica logo

CAS 108310-81-2

:

5-Chloro-2-(methylthio)thiazolo[5,4-b]pyridine

Description:
5-Chloro-2-(methylthio)thiazolo[5,4-b]pyridine is a heterocyclic compound characterized by its unique thiazole and pyridine ring structures. This compound features a chlorine atom and a methylthio group, which contribute to its chemical reactivity and potential biological activity. The thiazole ring is known for its role in various pharmacological applications, while the pyridine moiety often enhances solubility and stability. The presence of the chlorine atom can influence the compound's electronic properties, making it a candidate for various chemical reactions, including nucleophilic substitutions. Additionally, the methylthio group may enhance lipophilicity, potentially affecting the compound's interaction with biological targets. This substance is of interest in medicinal chemistry and may exhibit antimicrobial or antifungal properties, although specific biological activities would require further investigation. Overall, 5-Chloro-2-(methylthio)thiazolo[5,4-b]pyridine represents a versatile scaffold for the development of new therapeutic agents.
Formula:C7H5ClN2S2
InChI:InChI=1S/C7H5ClN2S2/c1-11-7-9-4-2-3-5(8)10-6(4)12-7/h2-3H,1H3
InChI key:InChIKey=SUYMXURAHBVKLQ-UHFFFAOYSA-N
SMILES:S(C)C1=NC=2C(S1)=NC(Cl)=CC2
Synonyms:
  • 5-Chloro-2-(methylthio)thiazolo[5,4-b]pyridine
  • Thiazolo[5,4-b]pyridine, 5-chloro-2-(methylthio)-
Sort by

The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.