CAS 1083168-67-5

1-(2,3-Dihydro-1H-inden-5-yl)cyclopropanecarboxylic acid

Description:

1-(2,3-Dihydro-1H-inden-5-yl)cyclopropanecarboxylic acid is a chemical compound characterized by its unique bicyclic structure, which includes a cyclopropane ring fused to a dihydroindene moiety. This compound features a carboxylic acid functional group, contributing to its acidity and potential reactivity. The presence of the cyclopropane ring imparts strain, which can influence the compound's stability and reactivity in various chemical reactions. Additionally, the bicyclic nature of the indene structure may provide interesting electronic properties, making it a candidate for applications in organic synthesis or medicinal chemistry. The compound's molecular interactions can be affected by steric and electronic factors due to its complex structure. As with many organic acids, it may exhibit solubility in polar solvents and could participate in hydrogen bonding. Overall, the unique structural features of 1-(2,3-Dihydro-1H-inden-5-yl)cyclopropanecarboxylic acid make it a subject of interest for further research in various chemical fields.

Formula: C₁₃H₁₄O₂

InChI: InChI=1S/C13H14O2/c14-12(15)13(6-7-13)11-5-4-9-2-1-3-10(9)8-11/h4-5,8H,1-3,6-7H2,(H,14,15)

InChI key: InChIKey=VTHPUCFLKLNHQU-UHFFFAOYSA-N

SMILES: C(O)(=O)C1(CC1)C=2C=C3C(=CC2)CCC3

Synonyms:

• Cyclopropanecarboxylic acid, 1-(2,3-dihydro-1H-inden-5-yl)-
• 1-(2,3-Dihydro-1H-inden-5-yl)cyclopropanecarboxylic acid