CymitQuimica logo

CAS 1083168-92-6

:

2,3-Dimethoxy-5-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)pyridine

Description:
2,3-Dimethoxy-5-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)pyridine is a chemical compound characterized by its unique structural features, which include a pyridine ring substituted with methoxy groups and a boron-containing moiety. The presence of the dimethoxy groups enhances its solubility and reactivity, while the dioxaborolane group contributes to its potential as a boron-based reagent in organic synthesis. This compound is typically used in various applications, including medicinal chemistry and materials science, due to its ability to participate in cross-coupling reactions and its role as a building block in the synthesis of more complex molecules. Its stability and reactivity can be influenced by the steric and electronic effects of the substituents, making it a valuable compound for research in synthetic organic chemistry. Safety data and handling precautions should be considered, as with any chemical substance, to ensure proper laboratory practices.
Formula:C13H20BNO4
InChI:InChI=1S/C13H20BNO4/c1-12(2)13(3,4)19-14(18-12)9-7-10(16-5)11(17-6)15-8-9/h7-8H,1-6H3
InChI key:InChIKey=CJHRJDZURRUHSH-UHFFFAOYSA-N
SMILES:CC1(C)OB(OC1(C)C)C=2C=C(OC)C(OC)=NC2
Found 4 products.