
CAS 1083169-02-1
:1-(2-Hydroxyethyl)-4-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)-2(1H)-pyridinone
Description:
1-(2-Hydroxyethyl)-4-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)-2(1H)-pyridinone, with the CAS number 1083169-02-1, is a chemical compound characterized by its unique structure that combines a pyridinone moiety with a boron-containing dioxaborolane group. This compound typically exhibits properties such as solubility in polar solvents due to the presence of the hydroxyethyl group, which enhances its hydrophilicity. The dioxaborolane unit contributes to its potential reactivity, particularly in applications involving boron chemistry, such as in organic synthesis and catalysis. The presence of the pyridinone ring suggests potential biological activity, as pyridinones are often explored for their pharmacological properties. Additionally, the compound may exhibit stability under various conditions, although specific stability and reactivity can depend on environmental factors such as pH and temperature. Overall, this compound represents a versatile structure with potential applications in both synthetic chemistry and medicinal chemistry.
Formula:C13H20BNO4
InChI:InChI=1S/C13H20BNO4/c1-12(2)13(3,4)19-14(18-12)10-5-6-15(7-8-16)11(17)9-10/h5-6,9,16H,7-8H2,1-4H3
InChI key:InChIKey=OTEJXDIXSHYGQQ-UHFFFAOYSA-N
SMILES:CC1(C)OB(OC1(C)C)C2=CC(=O)N(CCO)C=C2
Synonyms:- 1-(2-Hydroxyethyl)-4-(tetramethyl-1,3,2-dioxaborolan-2-yl)-1,2-dihydropyridin-2-one
- 2(1H)-Pyridinone, 1-(2-hydroxyethyl)-4-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)-
- 1-(2-Hydroxyethyl)-4-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)-2(1H)-pyridinone
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.