CAS 1083171-75-8

2-[[(1,1-Dimethylethyl)oxidoimino]methyl]-3,5,6-trimethylpyrazine

Description:

2-[[(1,1-Dimethylethyl)oxidoimino]methyl]-3,5,6-trimethylpyrazine is a chemical compound characterized by its unique structure, which includes a pyrazine ring substituted with multiple methyl groups and an oxidoimino functional group. The presence of the oxidoimino group suggests potential reactivity, particularly in forming bonds with electrophiles. The trimethyl substitutions on the pyrazine ring contribute to its hydrophobic nature, which may influence its solubility in various solvents. This compound may exhibit interesting biological activities due to its structural features, making it a candidate for research in fields such as medicinal chemistry or agrochemicals. Additionally, the bulky tert-butyl group can affect steric hindrance, potentially impacting its interactions with other molecules. Overall, the combination of functional groups and substituents in this compound suggests a complex behavior in chemical reactions and biological systems, warranting further investigation into its properties and applications.

Formula: C₁₂H₁₉N₃O

InChI: InChI=1S/C12H19N3O/c1-8-9(2)14-11(10(3)13-8)7-15(16)12(4,5)6/h7H,1-6H3

InChI key: InChIKey=BESRYENXPUCIID-UHFFFAOYSA-N

SMILES: C(=N(C(C)(C)C)=O)C=1C(C)=NC(C)=C(C)N1

Synonyms:

• 2-Propanamine, 2-methyl-N-[(3,5,6-trimethyl-2-pyrazinyl)methylene]-, N-oxide
• 2-[[(1,1-Dimethylethyl)oxidoimino]methyl]-3,5,6-trimethylpyrazine