CAS 1083181-27-4
:Ethyl 6-chloro-1H-pyrazolo[3,4-b]pyridine-3-carboxylate
Description:
Ethyl 6-chloro-1H-pyrazolo[3,4-b]pyridine-3-carboxylate is a heterocyclic compound characterized by its pyrazolo-pyridine structure, which incorporates both a pyrazole and a pyridine ring. This compound features a chloro substituent at the 6-position of the pyrazole ring and an ethyl ester functional group at the carboxylic acid position. Its molecular structure contributes to its potential biological activity, making it of interest in medicinal chemistry. The presence of the chloro group can enhance lipophilicity and influence the compound's reactivity and interaction with biological targets. Ethyl 6-chloro-1H-pyrazolo[3,4-b]pyridine-3-carboxylate may exhibit properties such as moderate solubility in organic solvents and stability under standard laboratory conditions. Its unique structure allows for potential applications in drug development, particularly in the search for new therapeutic agents. As with many heterocycles, the compound's reactivity can be influenced by the electronic effects of the substituents, making it a valuable subject for further research in organic and medicinal chemistry.
Formula:C9H8ClN3O2
InChI:InChI=1S/C9H8ClN3O2/c1-2-15-9(14)7-5-3-4-6(10)11-8(5)13-12-7/h3-4H,2H2,1H3,(H,11,12,13)
InChI key:InChIKey=DDWDCTIHADYWNP-UHFFFAOYSA-N
SMILES:C(OCC)(=O)C=1C=2C(NN1)=NC(Cl)=CC2
Synonyms:- 1H-Pyrazolo[3,4-b]pyridine-3-carboxylic acid, 6-chloro-, ethyl ester
- 6-Chloro-1H-pyrazolo[3,4-B]pyridine-3-carboxylic acid ethyl ester
- ethyl 6-chloro-1H-pyrazolo [3,4-b] pyridine-3-carboxylate
- Ethyl 6-chloro-1H-pyrazolo[3,4-b]pyridine-3-carboxylate
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.