CymitQuimica logo

CAS 1083181-43-4

:

6-Bromo-1-methyl-1H-benzo[d][1,2,3]triazole

Description:
6-Bromo-1-methyl-1H-benzo[d][1,2,3]triazole is a heterocyclic organic compound characterized by its triazole ring fused to a benzene structure. The presence of a bromine atom at the 6-position and a methyl group at the 1-position contributes to its unique chemical properties. This compound typically exhibits moderate solubility in organic solvents, reflecting its aromatic nature. It may participate in various chemical reactions, including nucleophilic substitutions and electrophilic aromatic substitutions, due to the reactivity of the bromine substituent. The triazole moiety is known for its biological activity, making this compound of interest in pharmaceutical research and development. Additionally, the compound's structure suggests potential applications in materials science, particularly in the development of functionalized polymers or ligands in coordination chemistry. Safety data should be consulted for handling and storage, as halogenated compounds can pose environmental and health risks. Overall, 6-Bromo-1-methyl-1H-benzo[d][1,2,3]triazole is a versatile compound with significant implications in various fields of chemistry.
Formula:C7H6BrN3
InChI:InChI=1/C7H6BrN3/c1-11-7-4-5(8)2-3-6(7)9-10-11/h2-4H,1H3
InChI key:GPKHIVIGTSWNRM-UHFFFAOYSA-N
SMILES:Cn1c2cc(ccc2nn1)Br
Synonyms:
  • 6-Bromo-1-methyl-1H-benzotriazole
  • 1H-Benzotriazole, 6-bromo-1-methyl-
  • 6-bromo-1-methyl-1H-1,2,3-benzotriazole
Found 4 products.